| Identification | |
| Name: | p-Chlorophenyl N-(4'-chlorophenyl)thiocarbamate |
| Synonyms: | 4-Chlorophenylthiocarbamic acid O-(4-chlorophenyl) ester |
| CAS: | 17710-62-2 |
| Molecular Formula: | C13H9Cl2NOS |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C13H9Cl2NOS/c14-9-1-5-11(6-2-9)16-13(18)17-12-7-3-10(15)4-8-12/h1-8H,(H,16,18) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 189°C |
| Boiling Point: | 388.9°C at 760 mmHg |
| Density: | 1.446g/cm3 |
| Refractive index: | 1.694 |
| Specification: |
p-Chlorophenyl N-(4'-chlorophenyl)thiocarbamate , its cas register number is 17710-62-2. It also can be called p-Chlorothiocarbanilic acid O-(p-chlorophenyl) ester ; and Carbanilic acid, p-chlorothio-, O-(p-chlorophenyl) ester . |
| Flash Point: | 189°C |
| Safety Data | |
 |
|
