Identification |
Name: | Benzene,1,3-dichloro-2-methoxy-5-nitro- |
Synonyms: | Anisole,2,6-dichloro-4-nitro- (6CI,7CI,8CI);3,5-Dichloro-4-methoxynitrobenzene;NSC 212118; |
CAS: | 17742-69-7 |
EINECS: | 403-350-6 |
Molecular Formula: | C7H5Cl2NO3 |
Molecular Weight: | 222.0255 |
InChI: | InChI=1/C7H5Cl2NO3/c1-13-7-5(8)2-4(10(11)12)3-6(7)9/h2-3H,1H3 |
Molecular Structure: |
 |
Properties |
Density: | 1.488 g/cm3 |
Refractive index: | 1.574 |
Water Solubility: | 26 mg l-1 (e) |
Solubility: | 16.1 MG/L (20oC) |
Appearance: | light brown |
Specification: |
2,6-DICHLORO-4-NITROANISOLE (17742-69-7) is stable under normal temperatures and pressures but incompatible with strong oxidizing agents.Hazardous decomposition products are Hydrogen chloride, carbon monoxide, oxides of nitrogen, carbon dioxide.
|
Safety Data |
Hazard Symbols |
N: Dangerous for the environment
T: Toxic
|
|
 |