| Identification | |
| Name: | 1H-Inden-1-one,2-bromo-2,3-dihydro- |
| Synonyms: | 1-Indanone,2-bromo- (6CI,7CI,8CI);2-bromo-2,3-dihydro-1H-inden-1-one;2-Bromoindanone;1H-inden-1-one, 2-bromo-2,3-dihydro-;2-Brom-2,3-dihydro-1H-inden-1-on;2-Bromo-1-Indanone;2-Bromoindan-1-one; |
| CAS: | 1775-27-5 |
| Molecular Formula: | C9H7BrO |
| Molecular Weight: | 211.05 |
| InChI: | InChI=1/C9H7BrO/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-4,8H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1759 |
| Density: | 0.862 g/cm3 |
| Refractive index: | 1.635 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
1H-Inden-1-one,2-bromo-2,3-dihydro- , with CAS number of 1775-27-5, can be called 2-Bromo-1-indanone ; 2-bromoindan-1-one ; 2-bromoindanone ; 2-bromoindanone, tech., 90% ; 2-bromo-1-indanone, tech., 88-92% ; 2-bromo-1-indanone: tech., 85% ; 2-Bromo-2,3-dihydroinden-1-one ; 2-Bromo-1-indanone , 88-92%,tech .It is a white to light yellow crystal powder. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
