| Identification | |
| Name: | N-(beta-Cyanoethyl)monochloroacetamide |
| Synonyms: | 2-chloro-n-(2-cyanoethyl)-acetamid;ceca;n-(beta-cyanoethyl)chloroacetamide;n-(beta-cyanoethyl)monochloroacetamide;nf21;udankor;N-(2-CYANOETHYL)CHLOROACETAMIDE;Udonkor |
| CAS: | 17756-81-9 |
| Molecular Formula: | C5H7ClN2O |
| Molecular Weight: | 146.57488 |
| InChI: | InChI=1/C5H7ClN2O/c6-4-5(9)8-3-1-2-7/h1,3-4H2,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 189°C |
| Boiling Point: | 388.9°C at 760 mmHg |
| Density: | 1.203g/cm3 |
| Refractive index: | 1.463 |
| Specification: |
N-(beta-Cyanoethyl)monochloroacetamide (CAS NO.17756-81-9) is also named as 2-Chloro-N-(2-cyanoethyl)acetamide ; BRN 2238620 ; CECA ; N-(beta-Cyanoethyl)chloroacetamide ; NF 21 ; Udankor ; Udonkor ; Acetamide, 2-chloro-N-(2-cyanoethyl)- . N-(beta-Cyanoethyl)monochloroacetamide (CAS NO.17756-81-9) is highly toxic. It will produce toxic nitrogen oxide and chloride gas when buring. So the storage environment should be ventilate, low-temperature and dry. Keep N-(beta-Cyanoethyl)monochloroacetamide (CAS NO.17756-81-9) separate from raw materials of food. |
| Flash Point: | 189°C |
| Safety Data | |
 |
|
