| Identification | |
| Name: | Piperazine,1-cyclohexyl- |
| Synonyms: | 4-Cyclohexylpiperazine;N-Cyclohexylpiperazine; |
| CAS: | 17766-28-8 |
| EINECS: | 241-750-0 |
| Molecular Formula: | C10H20N2 |
| Molecular Weight: | 168.28 |
| InChI: | InChI=1/C10H20N2/c1-2-4-10(5-3-1)12-8-6-11-7-9-12/h10-11H,1-9H2/p+2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 28-32 oC |
| Flash Point: | 103.3 oC |
| Boiling Point: | 255.7 oC at 760 mmHg |
| Density: | 0.969 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.6011 |
| Solubility: | Very soluble |
| Appearance: | Solid. |
| Specification: |
1-Cyclohexylpiperazine , with CAS number of 17766-28-8, can be called piperazine, 1-cyclohexyl- ; 1-Cyclohexylpiperazin . It is a yellow-brownish low melting solid. |
| Flash Point: | 103.3 oC |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. Keep containers tightly closed. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
