| Identification |
| Name: | 1-Adamantanemethylamine |
| Synonyms: | 1-Adamantanemethylamine(7CI,8CI);1-(Aminomethyl)adamantane;1-Adamantylmethanamine;Tricyclo(3.3.1.13,7)dec-1-ylmethylamine;IEM 1618;MRZ 2/16;NSC 285231;[(Adamantan-1-yl)methyl]amine; |
| CAS: | 17768-41-1 |
| EINECS: | 241-752-1 |
| Molecular Formula: | C11H19N |
| Molecular Weight: | 165.27526 [g/mol] |
| InChI: | InChI=1S/C11H19N/c12-7-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10H,1-7,12H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2735 |
| Density: | 1.039 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5127-1.5147 |
| Appearance: | clear colourless to very slightly yellow liquid |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
C: Corrosive
|
| |
 |
