| Identification |
| Name: | 1H-Imidazole,5-[3-(phenylmethoxy)propyl]- |
| Synonyms: | 1H-Imidazole,4-[3-(phenylmethoxy)propyl]- (9CI); Proxyfan |
| CAS: | 177708-09-7 |
| Molecular Formula: | C13H16 N2 O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C13H16N2O/c1-2-5-12(6-3-1)10-16-8-4-7-13-9-14-11-15-13/h1-3,5-6,9,11H,4,7-8,10H2,(H,14,15) |
| Molecular Structure: |
![(C13H16N2O) 1H-Imidazole,4-[3-(phenylmethoxy)propyl]- (9CI); Proxyfan](https://img1.guidechem.com/chem/e/dict/14/177708-09-7.jpg) |
| Properties |
| Flash Point: | 149.9°C |
| Boiling Point: | 414.5°Cat760mmHg |
| Density: | 1.115g/cm3 |
| Refractive index: | 1.572 |
| Biological Activity: | High affinity histamine H 3 receptor ligand (pK i = 8.62) that acts as a protean agonist at recombinant and native receptors. In functional studies, activity ranges from full agonist to inverse agonist depending on system used. Displays partial agonist effects on cAMP inhibition and MAPK activity, neutral antagonist activity on histamine release and partial inverse agonism of [ 3 H]-arachidonic acid release. |
| Flash Point: | 149.9°C |
| Safety Data |
| |
 |
