| Identification |
| Name: | 3-(propanoylamino)phenyl methylcarbamate |
| Synonyms: | Stauffer R 11520;Methylcarbamic acid ester with 3'-hydroxypropionanilide;ENT 27,481;BRN 2124297;AI3-27481;Propionanilide, 3-hydroxy-, methylcarbamate;R-11520;N-(3-(((Methylamino)carbonyl)oxy)phenyl)propanamide;CARBAMIC ACID, METHYL-, ESTER with 3'-HYDROXYPROPIONANILIDE;AC1L1G17;LS-50191;[3-(propanoylamino)phenyl] N-methylcarbamate;Propanamide, N-(3-(((methylamino)carbonyl)oxy)phenyl)- (9CI);17788-11-3 |
| CAS: | 17788-11-3 |
| Molecular Formula: | C11H14N2O3 |
| Molecular Weight: | 222.2405 |
| InChI: | InChI=1/C11H14N2O3/c1-3-10(14)13-8-5-4-6-9(7-8)16-11(15)12-2/h4-7H,3H2,1-2H3,(H,12,15)(H,13,14) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 196.2°C |
| Boiling Point: | 400.8°C at 760 mmHg |
| Density: | 1.198g/cm3 |
| Refractive index: | 1.561 |
| Flash Point: | 196.2°C |
| Safety Data |
| |
 |
