| Identification |
| Name: | Phenylphosphinic acid |
| Synonyms: | phenylphosphonous acid; Benzenephosphinic acid |
| CAS: | 1779-48-2 |
| EINECS: | 217-217-3 |
| Molecular Formula: | C6H7O2P |
| Molecular Weight: | 142.09 |
| InChI: | InChI=1/C6H7O2P/c7-9(8)6-4-2-1-3-5-6/h1-5,7-8H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3261 |
| Flash Point: | 204
C |
| Density: | g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | 7 - 8 g/100ml (Soluble
in alcohol and ketones) |
| Appearance: | White
crystals |
| Packinggroup: | III |
| Flash Point: | 204
C |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. Corrosives area. |
| Safety Data |
| Hazard Symbols |
C:Corrosive
Xn:Harmful
|
| |
 |
