| Identification | |
| Name: | 2,4-dichloro-5-methylpyrimidine |
| Synonyms: | 2,4-dichloro-5-methyl-pyrimidin;2,4-DICHLORO-5-METHYLPYRIMIDINE;2,4-Dichloro-5-methylpyrimidine;Toxic,stench;PYRIMIDINE,2,4-DICHLORO-5-METHYL;2,4-Dichloro-5-;5-Methyl-2,4-dichloropyrimidine;NSC 37532 |
| CAS: | 1780-31-0 |
| EINECS: | 217-227-8 |
| Molecular Formula: | C5H4Cl2N2 |
| Molecular Weight: | 163 |
| InChI: | InChI=1/C5H4Cl2N2/c1-3-2-8-5(7)9-4(3)6/h2H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Density: | 1.39 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.551 |
| Solubility: | 3.9 g/L (25 C) |
| Appearance: | white to off white low melting solid |
| Packinggroup: | III |
| Sensitive: | Lachrymatory |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
