| Identification |
| Name: | 3-Dimethylaminophenylboronic acid |
| Synonyms: | 3-(N,N-Dimethylamino)phenylboronic acid; |
| CAS: | 178752-79-9 |
| Molecular Formula: | C8H12BNO2 |
| Molecular Weight: | 165.00 |
| InChI: | InChI=1/C8H12BNO2/c1-10(2)8-5-3-4-7(6-8)9(11)12/h3-6,11-12H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 178-190 oC |
| Flash Point: | 161.9oC |
| Boiling Point: | 344oC at 760 mmHg |
| Density: | 1.12 g/cm3 |
| Refractive index: | 1.547 |
| Appearance: | White to Tan to Grey Powder, Crystals, Crystalline Powder and/or Chunks |
| Flash Point: | 161.9oC |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
