| Identification |
| Name: | Pyrrolidine,1-[2-(ethenyloxy)-1-oxidodiazenyl]- |
| Synonyms: | Pyrrolidine,1-[(ethenyloxy)-NNO-azoxy]- (9CI); O2-Vinyl1-(pyrrolidin-1-yl)diazen-1-ium-1,2-diolate; V-PYRRO/NO |
| CAS: | 179344-98-0 |
| Molecular Formula: | C6H11 N3 O2 |
| Molecular Weight: | 157.17 |
| InChI: | InChI=1/C6H11N3O2/c1-2-11-7-9(10)8-5-3-4-6-8/h2H,1,3-6H2/b9-7- |
| Molecular Structure: |
![(C6H11N3O2) Pyrrolidine,1-[(ethenyloxy)-NNO-azoxy]- (9CI); O2-Vinyl1-(pyrrolidin-1-yl)diazen-1-ium-1,2-diolate; ...](https://img1.guidechem.com/chem/e/dict/174/179344-98-0.jpg) |
| Properties |
| Transport: | UN 1170 3/PG 2 |
| Flash Point: | 14 °C |
| Boiling Point: | 220.232°C at 760 mmHg |
| Density: | 1.212g/cm3 |
| Refractive index: | 1.539 |
| Flash Point: | 14 °C |
| Storage Temperature: | −20°C |
| Usage: | V-PYRRO/NO is a metabolically activated nitric oxide (NO) donor drug that can be used to selectively target NO delivery to the liver. The compound is metabolized by the liver, and spontaneously decomposes with a half-life of 3 seconds, liberating N |
| Safety Data |
| Hazard Symbols |
F: Flammable
|
| |
 |
