| Identification | |
| Name: | Methane, chloronitro-(6CI,7CI,8CI,9CI) |
| Synonyms: | Chloronitromethane |
| CAS: | 1794-84-9 |
| EINECS: | 217-265-5 |
| Molecular Formula: | CH2 Cl N O2 |
| Molecular Weight: | 95.49 |
| InChI: | InChI=1/CH2ClNO2/c2-1-3(4)5/h1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 24.7°C |
| Boiling Point: | 122.5°Cat760mmHg |
| Density: | 1.379g/cm3 |
| Refractive index: | 1.421 |
| Specification: |
Chloronitromethane , its cas register number is 1794-84-9. It also can be called Nitrochloromethane and methane, chloronitro- .When heated to decomposition it emits toxic vapors of NOx and Cl−.And Chloronitromethane (CAS NO.1794-84-9) will cause cancer. Be careful when contact with it . |
| Flash Point: | 24.7°C |
| Safety Data | |
 |
|
