| Identification | |
| Name: | 3-Pyridinecarboxylicacid, 6-amino-4-methyl- |
| Synonyms: | 2-Amino-5-carboxy-4-methylpyridine; |
| CAS: | 179555-11-4 |
| Molecular Formula: | C7H8N2O2 |
| Molecular Weight: | 152.15062 |
| InChI: | InChI=1/C7H8N2O2/c1-4-2-6(8)9-3-5(4)7(10)11/h2-3H,1H3,(H2,8,9)(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.338 g/cm3 |
| Refractive index: | 1.627 |
| Specification: |
The 2-Amino-4-methyl-5-pyridinecarboxylic acid, with the CAS registry number 179555-11-4, is also known as 3-Pyridinecarboxylic acid, 6-amino-4-methyl-. It belongs to the product categories of Carboxylicacid; Pyridine. This chemical's molecular formula is C7H8N2O2 and formula weight is 152.15. What's more, its systematic name is called 6-amino-4-methylpyridine-3-carboxylic acid. Physical properties of 2-Amino-4-methyl-5-pyridinecarboxylic acid: (1)ACD/LogP: 0.47; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 4; (8)#H bond donors: 3; (9)#Freely Rotating Bonds: 1; (10)Polar Surface Area: 76.21 Å2; (11)Index of Refraction: 1.627; (12)Molar Refractivity: 40.335 cm3; (13)Molar Volume: 113.742 cm3; (14)Surface Tension: 68.336 dyne/cm; (15)Density: 1.338 g/cm3; (16)Flash Point: 180.537 °C; (17)Enthalpy of Vaporization: 65.654 kJ/mol; (18)Boiling Point: 374.905 °C at 760 mmHg; (19)Vapour Pressure: 0 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
