| Identification | |
| Name: | Carbamic acid, (methoxyacetyl)methyl-, o-isopropoxyphenyl ester |
| Synonyms: | Upjohn U-18120;ENT 27,350;NSC 190948;BRN 1890489;AI3-27350;U-18120;2-(1-Methylethoxy)phenyl (methoxyacetyl)methylcarbamate;Carbamic acid, (methoxyacetyl)methyl-, 2-(1-methylethoxy)phenyl ester;Carbamic acid,;AC1L1G71;LS-50022;(2-propan-2-yloxyphenyl) N-(3-methoxy-2-oxopropyl)carbamate;CARBAMIC ACID, (METHOXYACETYL)METHYL-, o-ISOPROPOXYPHENYL ESTER;17959-11-4 |
| CAS: | 17959-11-4 |
| Molecular Formula: | C14H19NO5 |
| Molecular Weight: | 281.3044 |
| InChI: | InChI=1/C14H19NO5/c1-10(2)19-12-6-4-5-7-13(12)20-14(17)15-8-11(16)9-18-3/h4-7,10H,8-9H2,1-3H3,(H,15,17) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 202.7°C |
| Boiling Point: | 411.6°C at 760 mmHg |
| Density: | 1.142g/cm3 |
| Refractive index: | 1.502 |
| Specification: |
Carbamic acid, (methoxyacetyl)methyl-, o-isopropoxyphenyl ester with cas registry number of 17959-11-4 is also called for 2-(1-Methylethoxy)phenyl (methoxyacetyl)methylcarbamate ; AI3-27350 ; Carbamic acid, (methoxyacetyl)methyl-, 2-(1-methylethoxy)phenyl ester ; ENT 27,350 ; NSC 190948 ; U-18120 ; Upjohn U-18120 . |
| Flash Point: | 202.7°C |
| Safety Data | |
 |
|
