Identification |
Name: | Benzeneacetic acid,2-propen-1-yl ester |
Synonyms: | Aceticacid, phenyl-, allyl ester (6CI,7CI,8CI); Benzeneacetic acid, 2-propenyl ester(9CI); Allyl phenylacetate; NSC 6574 |
CAS: | 1797-74-6 |
EINECS: | 217-281-2 |
Molecular Formula: | C11H12 O2 |
Molecular Weight: | 176.2118 |
InChI: | InChI=1/C11H12O2/c1-2-8-13-11(12)9-10-6-4-3-5-7-10/h2-7H,1,8-9H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 113 ºC |
Density: | 1.037 |
Refractive index: | 1.508 |
Appearance: | Colourless, slightly viscous liquid with a honey-like odour |
Specification: |
To protect yourself, you can put on eyeshields, faceshields, full-face respirator (US), gloves, multi-purpose combination respirator cartridge (US), type ABEK (EN14387) respirator filter.
|
Report: |
Reported in EPA TSCA Inventory.
|
Flash Point: | 113 ºC |
Safety Data |
Hazard Symbols |
Xn: Harmful
|
|
 |