| Identification | |
| Name: | Benzeneacetic acid,2-propen-1-yl ester |
| Synonyms: | Aceticacid, phenyl-, allyl ester (6CI,7CI,8CI); Benzeneacetic acid, 2-propenyl ester(9CI); Allyl phenylacetate; NSC 6574 |
| CAS: | 1797-74-6 |
| EINECS: | 217-281-2 |
| Molecular Formula: | C11H12 O2 |
| Molecular Weight: | 176.2118 |
| InChI: | InChI=1/C11H12O2/c1-2-8-13-11(12)9-10-6-4-3-5-7-10/h2-7H,1,8-9H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 113 ºC |
| Density: | 1.037 |
| Refractive index: | 1.508 |
| Appearance: | Colourless, slightly viscous liquid with a honey-like odour |
| Specification: |
To protect yourself, you can put on eyeshields, faceshields, full-face respirator (US), gloves, multi-purpose combination respirator cartridge (US), type ABEK (EN14387) respirator filter. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 113 ºC |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
