| Identification | |
| Name: | Benzene,1,2-bis(dimethylsilyl)- |
| Synonyms: | Silane,1,2-phenylenebis[dimethyl- (9CI);Silane, o-phenylenebis[dimethyl- (7CI,8CI);1,2-Bis(dimethylsilyl)benzene;o-Bis(dimethylsilyl)benzene;o-Phenylenebis(dimethylsilane); |
| CAS: | 17985-72-7 |
| Molecular Formula: | C10H18Si2. |
| Molecular Weight: | 194.42 |
| InChI: | InChI=1/C10H18Si2/c1-11(2)9-7-5-6-8-10(9)12(3)4/h5-8,11-12H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | <25°C |
| Density: | 0.89 |
| Refractive index: | 1.51-1.514 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Specification: |
The 1,2-Bis(dimethylsilyl)benzene with the cas number 17985-72-7 is also called Benzene,1,2-bis(dimethylsilyl)-. The systematic name is benzene-1,2-diylbis(dimethylsilane). Its molecular formula is C10H18Si2. This chemical belongs to the following product categories: (1)Protection & Derivatization Reagents (for Synthesis); (2)Si (Classes of Silicon Compounds); (3)Si-H Compounds; (4)Silicon Compounds (for Synthesis); (5)Synthetic Organic Chemistry. The properties of the chemical are: (1)ACD/LogP: 5.80; (2)# of Rule of 5 Violations: 1; (3)#H bond acceptors: 0; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 0 Å2; (7)Flash Point: 81.679 °C; (8)Enthalpy of Vaporization: 43.785 kJ/mol; (9)Boiling Point: 220.011 °C at 760 mmHg; (10)Vapour Pressure: 0.171 mmHg at 25°C. While using this chemical, you should be very cautious. This chemical is not only irritating to skin, but also irritating to eyes and respiratory system. Therefore, you should take the following instructions. Firstly, you should not breathe vapour. Then you should avoid this chemical contact with skin and eyes. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
