| Identification | |
| Name: | 3-Pyridinecarboxylicacid, 6-amino-5-bromo- |
| Synonyms: | 6-Amino-5-bromonicotinicacid;6-Amino-5-bromopyridine-3-carboxylic acid; |
| CAS: | 180340-69-6 |
| Molecular Formula: | C6H5BrN2O2 |
| Molecular Weight: | 217.02 |
| InChI: | InChI=1/C6H5BrN2O2/c7-4-1-3(6(10)11)2-9-5(4)8/h1-2H,(H2,8,9)(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.91 g/cm3 |
| Refractive index: | 1.685 |
| Specification: |
The 6-Amino-5-bromonicotinic acid with the cas number 180340-69-6 is also called 3-Pyridinecarboxylicacid, 6-amino-5-bromo-. The systematic name is 6-amino-5-bromopyridine-3-carboxylic acid. Its molecular formula is C6H5BrN2O2. This chemical is irritant. While using this chemical, you should be very cautious. The properties of the chemical are: (1)ACD/LogP: 1.70; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 5; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 4; (9)#H bond donors: 3; (10)#Freely Rotating Bonds: 1; (11)Polar Surface Area: 76.21 Å2; (12)Index of Refraction: 1.685; (13)Molar Refractivity: 43.2 cm3; (14)Molar Volume: 113.652 cm3; (15)Polarizability: 17.126×10-24cm3; (16)Surface Tension: 79.982 dyne/cm; (17)Enthalpy of Vaporization: 66.019 kJ/mol; (18)Vapour Pressure: 0 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
