| Identification | |
| Name: | D-6-Methyl-8-cyanomethylergoline |
| Synonyms: | Ergoline-8-acetonitrile,6-methyl-,(8a)-;LY 79344;6605 VUFB;d-6-METHYLERGOLINE-8-ACETONITRILE; |
| CAS: | 18051-18-8 |
| Molecular Formula: | C17H19N2 |
| Molecular Weight: | 265.35286 |
| InChI: | InChI=1S/C17H19N3/c1-20-10-11(5-6-18)7-14-13-3-2-4-15-17(13)12(9-19-15)8-16(14)20/h2-4,9,11,14,16,19H,5,7-8,10H2,1H3/t11-,14?,16-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 256.7°C |
| Boiling Point: | 500.9°Cat760mmHg |
| Density: | 1.179g/cm3 |
| Specification: |
D-6-Methyl-8-cyanomethylergoline (CAS NO.18051-18-8) is also named as CM 29-712 ; 6-Methyl-8-cyanomethylergoline, D- ; 6-Methyl-8-cyanomethylergoline, d- ; 6-Methylergoline-8-beta-acetonitrile ; 6605 VUFB ; |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 256.7°C |
| Safety Data | |
 |
|
