| Identification |
| Name: | Phenol, 4-octyl- |
| Synonyms: | Phenol,p-octyl- (6CI,7CI,8CI); 4-Octylphenol; 4-n-Octylphenol; p-(n-Octyl)phenol;p-Octylphenol |
| CAS: | 1806-26-4 |
| EINECS: | 217-302-5 |
| Molecular Formula: | C14H22 O |
| Molecular Weight: | 206.3239 |
| InChI: | InChI=1S/C14H22O/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13/h9-12,15H,2-8H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Melting Point: | 41 C |
| Flash Point: | 110 C |
| Boiling Point: | 150 C |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Solubility: | | | Appearance: | white to off-white Solid |
| Packinggroup: | III |
| Flash Point: | 110 C |
| Safety Data |
| Hazard Symbols |
|
| |
 |
