| Identification |
| Name: | 2,6-Difluorobenzoyl chloride |
| Synonyms: | 2,6-Difluorobenzoylchloride |
| CAS: | 18063-02-0 |
| EINECS: | 241-971-2 |
| Molecular Formula: | C7H3ClF2O |
| Molecular Weight: | 176.55 |
| InChI: | InChI=1/C7H3ClF2O/c8-7(11)6-4(9)2-1-3-5(6)10/h1-3H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2920 |
| Melting Point: | 128-132 °C(lit.)
|
| Density: | 1.404 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4988-1.5008 |
| Water Solubility: | REACTS |
| Solubility: | REACTS with water |
| Appearance: | colorless liquid |
| Packinggroup: | II |
| Storage Temperature: | 2-8°C |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
