| Identification |
| Name: | 2,6-Difluorobenzamide |
| Synonyms: | 2,6-Difluorobenzamide |
| CAS: | 18063-03-1 |
| EINECS: | 241-972-8 |
| Molecular Formula: | C7H5F2NO |
| Molecular Weight: | 157.12 |
| InChI: | InChI=1/C7H5F2NO/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H2,10,11) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Flash Point: | 67.3 oC |
| Boiling Point: | 187.7 oC at 760 mmHg |
| Density: | 1.348 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1,508 |
| Water Solubility: | SOLVENT |
| Solubility: | SOLVENT |
| Appearance: | white to off-white powder |
| Flash Point: | 67.3 oC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
