| Identification | |
| Name: | 4-Isopropylnitrobenzene |
| Synonyms: | 4-Isopropylnitrobenzene~4-Nitrocumene; 1-(1-methylethyl)-4-nitro-benzene; 4-Nitrocumene; 1-Isopropyl-4-Nitrobenzene; 4-Nitro-Isopropylbenzene |
| CAS: | 1817-47-6 |
| EINECS: | 217-326-6 |
| Molecular Formula: | C9H11NO2 |
| Molecular Weight: | 165.19 |
| InChI: | InChI=1/C9H11NO2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h3-7H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 100 C (closed cup) |
| Density: | 1.09 |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. |
| Refractive index: | n20/D 1.537(lit.) |
| Water Solubility: | Stability Stable. Incompatible with strong bases, strong oxidizing agents. Toxicology Skin, eye and respiratory irritant. Toxicology not fully investigated. Toxicity data |
| Solubility: |
|
| Appearance: | Yellow-green liquid |
| Specification: | yellow-green liquid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 100 C (closed cup) |
| Safety Data | |
 |
|
