| Identification | |
| Name: | Benzenemethanol, a-(2-phenylethynyl)- |
| Synonyms: | 2-Propyn-1-ol,1,3-diphenyl- (6CI,7CI,8CI); Benzenemethanol, a-(phenylethynyl)- (9CI); 1,3-Diphenyl-2-propyn-1-ol;1,3-Diphenylpropargyl alcohol; NSC 167103 |
| CAS: | 1817-49-8 |
| Molecular Formula: | C15H12 O |
| Molecular Weight: | 208.25518 |
| InChI: | InChI=1/C15H12O/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-10,15-16H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 9/PG 3 |
| Flash Point: | 170.4°C |
| Boiling Point: | 364.7°Cat760mmHg |
| Density: | 1.14g/cm3 |
| Refractive index: | n20/D 1.618 |
| Specification: | Safety Statements:26-61 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Flash Point: | 170.4°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
