| Identification | |
| Name: | 4-Chloro-7-hydroxyquinoline |
| Synonyms: | 7-Quinolinol, 4-chloro-; |
| CAS: | 181950-57-2 |
| Molecular Formula: | C9H6ClNO |
| Molecular Weight: | 179.60 |
| InChI: | InChI=1/C9H6ClNO/c10-8-3-4-11-9-5-6(12)1-2-7(8)9/h1-5,12H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.412 g/cm3 |
| Refractive index: | 1.697 |
| Specification: |
The 4-Chloro-7-hydroxyquinoline with the CAS number 181950-57-2 is also called 7-Quinolinol, 4-chloro-. The systematic name is 4-chloroquinolin-7-ol. Its molecular formula is C9H6ClNO. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the 4-Chloro-7-hydroxyquinoline are: (1)ACD/LogP: 3.56; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4; (4)ACD/LogD (pH 7.4): 4; (5)ACD/BCF (pH 5.5): 282; (6)ACD/BCF (pH 7.4): 264; (7)ACD/KOC (pH 5.5): 1939; (8)ACD/KOC (pH 7.4): 1817; (9)#H bond acceptors: 2; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 33.12 Å2; (13)Index of Refraction: 1.697; (14)Molar Refractivity: 48.963 cm3; (15)Molar Volume: 127.154 cm3; (16)Polarizability: 19.411×10-24cm3; (17)Surface Tension: 61.539 dyne/cm; (18)Enthalpy of Vaporization: 59.447 kJ/mol; (19)Vapour Pressure: 0 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
