| Identification | |
| Name: | Pentanoic acid, 2-oxo- |
| Synonyms: | Valericacid, 2-oxo- (6CI,7CI,8CI); 2-Ketopentanoic acid; 2-Ketovaleric acid;2-Oxo-n-valeric acid; 2-Oxopentanoic acid; 2-Oxovaleric acid; a-Ketovaleric acid; a-Oxo-n-valeric acid; a-Oxopentanoic acid; a-Oxovaleric acid; a-keto-Valeric acid |
| CAS: | 1821-02-9 |
| EINECS: | 217-340-2 |
| Molecular Formula: | C5H8 O3 |
| Molecular Weight: | 116.12 |
| InChI: | InChI=1/C5H8O3/c1-2-3-4(6)5(7)8/h2-3H2,1H3,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 7-9 °C(lit.) |
| Flash Point: | 76.6°C |
| Boiling Point: | 88-90 °C12 mm Hg(lit.) |
| Density: | 1.129g/cm3 |
| Refractive index: | n20/D 1.432 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 76.6°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
