Identification |
Name: | Boronic acid,B-[4-[(tetrahydro-2H-pyran-2-yl)oxy]phenyl]- |
Synonyms: | Boronicacid, [4-[(tetrahydro-2H-pyran-2-yl)oxy]phenyl]- (9CI);4-Hydroxyphenylboronicacid tetrahydropyranyl ether;[4-(2-Tetrahydropyranyloxy)phenyl]boronic acid;[4-[(Tetrahydro-2H-pyran-2-yl)oxy]phenyl]boronic acid; |
CAS: | 182281-01-2 |
Molecular Formula: | C11H15BO4 |
Molecular Weight: | 222.04 |
InChI: | InChI=1/C11H15BO4/c13-12(14)9-4-6-10(7-5-9)16-11-3-1-2-8-15-11/h4-7,11,13-14H,1-3,8H2 |
Molecular Structure: |
|
Properties |
Flash Point: | 202.5°C |
Boiling Point: | 411.3°Cat760mmHg |
Density: | 1.21g/cm3 |
Refractive index: | 1.543 |
Appearance: | off-white to beige crystalline powder |
Specification: |
The 4-(2-Tetrahydropyranyloxy)phenylboronic acid(182281-01-2) is stable under normal temperatures and pressures but incompatible with light, acids, strong bases.It can be store temp at 0-6°C.Hazardous decomposition products are carbon monoxide, carbon dioxide, boron oxides.
|
Flash Point: | 202.5°C |
Storage Temperature: | 0-6°C |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
|