Identification |
Name: | 2H-1,4-Benzodiazepin-2-one,3-(acetyloxy)-7-chloro-1,3-dihydro-5-phenyl- |
CAS: | 1824-74-4 |
EINECS: | 217-359-6 |
Molecular Formula: | C17H13 Cl N2 O3 |
Molecular Weight: | 328.74972 |
InChI: | InChI=1/C17H13ClN2O3/c1-10(21)23-17-16(22)19-14-8-7-12(18)9-13(14)15(20-17)11-5-3-2-4-6-11/h2-9,17H,1H3,(H,19,22) |
Molecular Structure: |
 |
Properties |
Flash Point: | 254.9°C |
Boiling Point: | 497.8°Cat760mmHg |
Density: | 1.37g/cm3 |
Refractive index: | 1.644 |
Specification: | usageEng:A benzodiazepine derivative with anticonvulsant and muscle relaxant properties. An ester of Oxazepam (O845700).
Controlled Substance. |
Flash Point: | 254.9°C |
Usage: | A benzodiazepine derivative with anticonvulsant and muscle relaxant properties. An ester of Oxazepam (O845700).
Controlled Substance. |
Safety Data |
|
 |