| Identification | |
| Name: | b-D-Galactopyranoside, methyl |
| Synonyms: | Galactopyranoside,methyl, b-D- (8CI);1-O-Methyl-b-D-galactopyranoside;Methylgalactoside;Methyl b-D-galactopyranoside;Methyl b-D-galactoside;Methyl b-galactoside;NSC 33685;b-Methylgalactose; |
| CAS: | 1824-94-8 |
| EINECS: | 211-909-9 |
| Molecular Formula: | C7H14O6 |
| Molecular Weight: | 194.182 |
| InChI: | InChI=1/C7H14O6/c1-12-7-6(11)5(10)4(9)3(2-8)13-7/h3-11H,2H2,1H3/t3-,4+,5+,6-,7-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.47 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | -16.5 ° (C=1.5, MeOH) |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology May be harmful or act as an irritant - toxicology not fully investigated. Toxicity data |
| Solubility: |
|
| Appearance: | white crystalline powder |
| Specification: | White Crystalline Solid Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
