Naphthalene,1,5-dichloro- (1825-30-5)

The 1,5-Dichloronaphthalene, with CAS registry number 1825-30-5, belongs to the following product category: Naphthalene derivatives. It has the systematic name of 1,5-dichloronaphthalene. Besides this, it is also called naphthalene, 1,5-dichloro-. What's more, its EINECS is 217-364-3.

Physical properties of 1,5-Dichloronaphthalene: (1)ACD/LogP: 4.52; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4.52; (4)ACD/LogD (pH 7.4): 4.52; (5)ACD/BCF (pH 5.5): 1612.42; (6)ACD/BCF (pH 7.4): 1612.42; (7)ACD/KOC (pH 5.5): 6878.77; (8)ACD/KOC (pH 7.4): 6878.77; (9)#H bond acceptors: 0; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 0 Å²; (13)Index of Refraction: 1.651; (14)Molar Refractivity: 53.88 cm³; (15)Molar Volume: 147.4 cm³; (16)Polarizability: 21.36×10^-24cm³; (17)Surface Tension: 45.4 dyne/cm; (18)Enthalpy of Vaporization: 51.51 kJ/mol; (19)Vapour Pressure: 0.00248 mmHg at 25°C.

Uses of 1,5-Dichloronaphthalene: it can be used to produce naphthalene. This reaction will need reagent C₈K and solvent tetrahydrofuran. The reaction time is 15 min. The yield is about 82%.

You can still convert the following datas into molecular structure:
(1)SMILES: Clc1cccc2c1cccc2Cl
(2)InChI: InChI=1/C10H6Cl2/c11-9-5-1-3-7-8(9)4-2-6-10(7)12/h1-6H
(3)InChIKey: ZBQZXTBAGBTUAD-UHFFFAOYAQ
(4)Std. InChI: InChI=1S/C10H6Cl2/c11-9-5-1-3-7-8(9)4-2-6-10(7)12/h1-6H
(5)Std. InChIKey: ZBQZXTBAGBTUAD-UHFFFAOYSA-N