| Identification | |
| Name: | 1,4-Benzenediamine,2-nitro-, hydrochloride (1:2) |
| Synonyms: | 1,4-Benzenediamine,2-nitro-, dihydrochloride (9CI); p-Phenylenediamine, 2-nitro-, dihydrochloride(8CI) |
| CAS: | 18266-52-9 |
| EINECS: | 242-144-9 |
| Molecular Formula: | C6H7 N3 O2 . 2 Cl H |
| Molecular Weight: | 226.06056 |
| InChI: | InChI=1/C6H7N3O2.2ClH/c7-4-1-2-5(8)6(3-4)9(10)11;;/h1-3H,7-8H2;2*1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 140 deg C |
| Flash Point: | 186.9°C |
| Boiling Point: | 385.4°Cat760mmHg |
| Density: | 1.446g/cm3 |
| Solubility: | Slightly sol in water (0.18% w/w); ethanol, polar organic compounds and benzene; soluble in acetone and diethyl ether In water, 2.49X10+4 mg/L at 25 deg C (est) |
| Flash Point: | 186.9°C |
| Color: | Almost black needles with dark-green luster |
| Safety Data | |
 |
|
