| Identification |
| Name: | Benzaldehyde,4-hydroxy-2-methoxy- |
| Synonyms: | 4-Hydroxy-o-anisaldehyde; |
| CAS: | 18278-34-7 |
| Molecular Formula: | C8H8O3 |
| Molecular Weight: | 152.15 |
| InChI: | InChI=1S/C8H8O3/c1-11-8-4-7(10)3-2-6(8)5-9/h2-5,10H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.231 g/cm3 |
| Refractive index: | 1.587 |
| Water Solubility: | practically insoluble |
| Solubility: | practically insoluble |
| Appearance: | light-yellow crystalline powder |
| Sensitive: | Air Sensitive |
| Usage: | A useful intermediate in the sythesis of solid phase supports for the preparation of fully protected peptide fragments |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
