| Identification | |
| Name: | 1-Cyclohexene-1-aceticacid |
| Synonyms: | 1-Cyclohexenylaceticacid; 2-(Cyclohex-1-enyl)acetic acid; Cyclohexene-1-acetic acid; NSC 14103 |
| CAS: | 18294-87-6 |
| EINECS: | 242-172-1 |
| Molecular Formula: | C8H12 O2 |
| Molecular Weight: | 140.18 |
| InChI: | InChI=1/C8H12O2/c9-8(10)6-7-4-2-1-3-5-7/h4H,1-3,5-6H2,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 149.7°C |
| Density: | 1.078g/cm3 |
| Refractive index: | 1.4775 |
| Specification: |
1-Cyclohexene-1-aceticacid , its cas register number is 18294-87-6. It also can be called Cyclohex-1-en-1-ylacetic acid ; and 1-Cyclohexenylacetic acid . |
| Flash Point: | 149.7°C |
| Safety Data | |
 |
|
