| Identification | |
| Name: | Dimethyl 1,3-acetonedicarboxylate |
| Synonyms: | Glutaricacid, 3-oxo-, dimethyl ester (6CI,7CI,8CI);Pentanedioic acid, 3-oxo-, dimethylester (9CI);3-Oxopentanedioic acid dimethyl ester;Acetone dicarboxylic aciddimethyl ester;Dimethyl 3-oxopentanedioate;Dimethyl b-oxoglutarate;b-Oxoglutaric acid dimethyl ester; |
| CAS: | 1830-54-2 |
| EINECS: | 217-385-8 |
| Molecular Formula: | C7H10O5 |
| Molecular Weight: | 174.15 |
| InChI: | InChI=1/C7H10O5/c1-11-6(9)3-5(8)4-7(10)12-2/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.185 |
| Stability: | Stable under normal temperatures and pressures. Moisture sensitive. |
| Refractive index: | 1.443-1.445 |
| Solubility: | 120 g/L (20 oC) in water |
| Appearance: | Colorless or pale yellow liquid |
| Specification: |
? Dimethyl acetone-1,3-dicarboxylate , with CAS number of 1830-54-2, can be called Acetone dicarboxylic acid, dimethyl ester ; Dimethyl 3-oxoglutarate ; Dimethyl 3-oxopentanedioate ; Dimethyl acetonedicarboxylate ; Dimethyl beta-oxoglutarate ; Glutaric acid, 3-oxo-, dimethyl ester . It is a?colorless to yellowish, Dimethyl acetone-1,3-dicarboxylate (CAS NO.1830-54-2)?is used as intermediate for the syntheses of organic chemicals. |
| Usage: | Dimethyl 1,3-acetonedicarboxylate is used as intermediate for the syntheses of organic chemicals. Product Data Sheet |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
