Identification |
Name: | Heptanoic acid,4-methyl-2-oxo-2H-1-benzopyran-7-yl ester |
Synonyms: | Heptanoicacid, ester with 7-hydroxy-4-methylcoumarin (8CI); Coumarin,7-hydroxy-4-methyl-, heptanoate (8CI); 4-Methylumbelliferone heptanoate;4-Methylumbelliferyl heptanoate; Heptanoyl 4-methylumbelliferone |
CAS: | 18319-92-1 |
EINECS: | 242-207-0 |
Molecular Formula: | C17H20 O4 |
Molecular Weight: | 288.34 |
InChI: | InChI=1/C17H20O4/c1-3-4-5-6-7-16(18)20-13-8-9-14-12(2)10-17(19)21-15(14)11-13/h8-11H,3-7H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Melting Point: | 41-42 °C(lit.)
|
Flash Point: | 214.5°C |
Boiling Point: | 429°Cat760mmHg |
Density: | 1.129g/cm3 |
Refractive index: | 1.531 |
Flash Point: | 214.5°C |
Storage Temperature: | −20°C |
Safety Data |
|
 |