| Identification |
| Name: | 2-Propen-1-amine,N-ethyl-2-methyl- |
| Synonyms: | Allylamine,N-ethyl-2-methyl- (6CI,8CI); N-2-Methylallyl-N-ethylamine;N-Ethyl-2-methylallylamine; N-Ethylmethallylamine |
| CAS: | 18328-90-0 |
| EINECS: | 242-217-5 |
| Molecular Formula: | C6H13 N |
| Molecular Weight: | 99.17 |
| InChI: | InChI=1/C6H13N/c1-4-7-5-6(2)3/h7H,2,4-5H2,1,3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2733 |
| Flash Point: | 45? |
| Density: | 0.753 |
| Stability: | No data. |
| Refractive index: | 1.4221 |
| Solubility: | Very soluble |
| Packinggroup: | II |
| Flash Point: | 45? |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data |
| Hazard Symbols |
F:Flammable
C:Corrosive
|
| |
 |
