| Identification | |
| Name: | Pyridine,2-chloro-5-methyl- |
| Synonyms: | 3-Picoline,6-chloro- (6CI,8CI);2-Chloro-5-picoline; |
| CAS: | 18368-64-4 |
| EINECS: | 418-050-0 |
| Molecular Formula: | C6H6ClN |
| Molecular Weight: | 127.57 |
| InChI: | InChI=1/C6H6ClN/c1-5-2-3-6(7)8-4-5/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 97 oC (30 MMHG) |
| Density: | 1.169 |
| Stability: | No data. |
| Refractive index: | 1.526-1.53 |
| Appearance: | Colorless liquid |
| Specification: |
?2-Chloro-5-methylpyridine (CAS NO.18368-64-4) is also named as 2-Chlor-5-methylpyridin?; 3-Picoline, 6-chloro- ; 6-Chloro-3-picoline ; Pyridine, 2-chloro-5-methyl- ; 6-Chloro-3-methylpyridine . It?is clear light yellow to straw-yellow liquid. |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
