| Identification |
| Name: | Cyclohexane,1,2,3,4,5,6-hexabromo- |
| Synonyms: | 1,2,3,4,5,6-Hexabromocyclohexane;Benzene hexabromide; NSC 7908 |
| CAS: | 1837-91-8 |
| EINECS: | 250-052-5 |
| Molecular Formula: | C6H6 Br6 |
| Molecular Weight: | 557.54 |
| InChI: | InChI=1/C6H6Br6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 183.4°C |
| Boiling Point: | 388.9°C at 760 mmHg |
| Density: | 2.894g/cm3 |
| Refractive index: | 1.699 |
| Biological Activity: | Potently and directly inhibits JAK2 tyrosine kinase autophosphorylation, specifically inhibiting ligand-dependent JAK2 activation. A 16-hour treatment with 1 μ M of compound reduces JAK2 tyrosine autophosphorylation levels to ~ 50% while 50 μ M elimates nearly all JAK2 activity. Non-cytotoxic at 100 μ M. |
| Flash Point: | 183.4°C |
| Safety Data |
| |
 |
