Identification |
Name: | Cyclohexane,1,2,3,4,5,6-hexabromo- |
Synonyms: | 1,2,3,4,5,6-Hexabromocyclohexane;Benzene hexabromide; NSC 7908 |
CAS: | 1837-91-8 |
EINECS: | 250-052-5 |
Molecular Formula: | C6H6 Br6 |
Molecular Weight: | 557.54 |
InChI: | InChI=1/C6H6Br6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H |
Molecular Structure: |
 |
Properties |
Flash Point: | 183.4°C |
Boiling Point: | 388.9°C at 760 mmHg |
Density: | 2.894g/cm3 |
Refractive index: | 1.699 |
Biological Activity: | Potently and directly inhibits JAK2 tyrosine kinase autophosphorylation, specifically inhibiting ligand-dependent JAK2 activation. A 16-hour treatment with 1 μ M of compound reduces JAK2 tyrosine autophosphorylation levels to ~ 50% while 50 μ M elimates nearly all JAK2 activity. Non-cytotoxic at 100 μ M. |
Flash Point: | 183.4°C |
Safety Data |
|
 |