Identification |
Name: | b-D-Glucopyranoside, phenylmethyl4-O-b-D-galactopyranosyl- |
Synonyms: | Glucopyranoside,benzyl 4-O-b-D-galactopyranosyl-, b-D- (8CI); Benzyl 4-O-b-D-galactopyranosyl-b-D-glucopyranoside; Benzyl b-lactoside |
CAS: | 18404-72-3 |
Molecular Formula: | C19H28 O11 |
Molecular Weight: | 432.41902 |
InChI: | InChI=1/C22H32O11/c1-22(2)32-18-13(9-24)30-21(16(27)19(18)33-22)31-17-12(8-23)29-20(15(26)14(17)25)28-10-11-6-4-3-5-7-11/h3-7,12-21,23-27H,8-10H2,1-2H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 377.8°C |
Boiling Point: | 701.1°C at 760 mmHg |
Density: | 1.45g/cm3 |
Refractive index: | 1.61 |
Flash Point: | 377.8°C |
Storage Temperature: | −20°C |
Usage: | A nonionic detergent for the solubilization of membrane bound protein. |
Safety Data |
|
|