N-(2-oxo-2-phenylethyl)acetamide (1846-33-9)

The N-(2-Oxo-2-phenylethyl)acetamide with the cas number 1846-33-9 is also called N-phenacylacetamide. Its molecular formula is C₁₀H₁₁NO₂. This chemical is a kind of organics. It should be stored in dry and cool environment.

The properties of the chemical are: (1)ACD/LogP: 0.43; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.43; (4)ACD/LogD (pH 7.4): 0.43; (5)ACD/BCF (pH 5.5): 1.25; (6)ACD/BCF (pH 7.4): 1.25; (7)ACD/KOC (pH 5.5): 40.73; (8)ACD/KOC (pH 7.4): 40.73; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 37.38 Å²; (13)Index of Refraction: 1.527; (14)Molar Refractivity: 49.17 cm³; (15)Molar Volume: 159.9 cm³; (16)Polarizability: 19.49×10^-24cm³; (17)Surface Tension: 41.1 dyne/cm; (18)Enthalpy of Vaporization: 64.32 kJ/mol; (19)Vapour Pressure: 2.14×10^-6 mmHg at 25°C.

Preparation: This chemical can be prepared by the reaction of acetic acid anhydride and 2-amino-1-phenyl-ethanone; hydrochloride. This reaction needs reagent sodium acetate.

Uses: This chemical can prepare 2-methyl-5-phenyl-oxazole. This reaction needs reagent phosphorus pentachloride.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(c1ccccc1)CNC(=O)C
(2)InChI: InChI=1/C10H11NO2/c1-8(12)11-7-10(13)9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,11,12)
(3)InChIKey: PKAGJSPRMNFMPN-UHFFFAOYAT