| Identification | |
| Name: | 2,5-Furandione,3-decyldihydro- |
| Synonyms: | Succinicanhydride, decyl- (8CI); Decylsuccinic anhydride; NSC 80684; n-Decylsuccinicanhydride |
| CAS: | 18470-76-3 |
| EINECS: | 242-350-9 |
| Molecular Formula: | C14H24 O3 |
| Molecular Weight: | 240.38 |
| InChI: | InChI=1/C14H24O3/c1-2-3-4-5-6-7-8-9-10-12-11-13(15)17-14(12)16/h12H,2-11H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 69 °C |
| Flash Point: | 160.7°C |
| Boiling Point: | 359.3°Cat760mmHg |
| Density: | 0.991g/cm3 |
| Refractive index: | 1.462 |
| Specification: |
n-Decylsuccinic anhydride , its cas register number is 18470-76-3. It also can be called 4-17-00-05889 (Beilstein Handbook Reference) ; BRN 0168302 ; Decylsuccinic anhydride ; EINECS 242-350-9 ; NSC 80684 ; Succinic anhydride, decyl- . n-Decylsuccinic anhydride (CAS NO.18470-76-3) is irritating to eyes, respiratory system and skin.In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. And you should wear suitable protective clothing, gloves and eye/face protection when contact with it. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 160.7°C |
| Safety Data | |
 |
|
