| Identification | |
| Name: | (S)-(-)-2,2'-Diamino-1,1'-binaphthalene |
| Synonyms: | [1,1'-Binaphthalene]-2,2'-diamine,(S)-;[1,1'-Binaphthalene]-2,2'-diamine, (S)-(-)- (8CI);(-)-1,1'-Binaphthyl-2,2'-diamine;(S)-(-)-1,1'-Binaphthalene-2,2'-diamine;(S)-(-)-2,2'-Diamino-1,1'-binaphthyl;(S)-1,1'-Binaphthyl-2,2'-diamine;(S)-2,2'-Diamino-1,1'-binaphthalene;(S)-2,2'-Diamino-1,1'-binaphthyl;(S)-BINAM;(S)-[1,1'-Binaphthalene]-2,2'-diamine; |
| CAS: | 18531-95-8 |
| EINECS: | 242-476-4 |
| Molecular Formula: | C20H16N2 |
| Molecular Weight: | 284.36 |
| InChI: | InChI=1/C10H9BrO4/c1-14-9(12)6-3-4-7(8(11)5-6)10(13)15-2/h3-5H,1-2H3 |
| Molecular Structure: | ![(C20H16N2) [1,1'-Binaphthalene]-2,2'-diamine,(S)-;[1,1'-Binaphthalene]-2,2'-diamine, (S)-(-)- (8CI);(-)-1,1'-Bi...](https://img.guidechem.com/casimg/18531-95-8.gif) |
| Properties | |
| Density: | 1.25 g/cm3 |
| Refractive index: | 1.546 |
| Alpha: | -156 º (C=1, PYRIDINE) |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble in water |
| Appearance: | off-white to beige powder |
| Specification: |
(S)-(-)-1,1'-Binaphthyl-2,2'-diamine (CAS NO.18531-95-8) is also named as [1,1'-binaphthalene]-2,2'-diamine ; 1,1'-Binaphthalene-2,2'-diamine ; 2,2'-diamino-1,1'-binaphthalene ; (1,1'-Binaphthalene)-2,2'-diamine ; (R)-(+)-1,1'-Bi(2-naphthylamine) ; (R)-(+)-2,2'-Diamino-1,1'-binaphthalene ; (R)-(+)-2,2'-Diamino-1,1'-binaphthyl ; (R)-BINAM . (S)-(-)-1,1'-Binaphthyl-2,2'-diamine (CAS NO.18531-95-8) is off-white to beige powder. |
| Color: | slightly beige |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
