| Identification |
| Name: | Benzeneethanamine,3-methoxy-4-(phenylmethoxy)-, hydrochloride (1:1) |
| Synonyms: | Benzeneethanamine,3-methoxy-4-(phenylmethoxy)-, hydrochloride (9CI); Phenethylamine,4-(benzyloxy)-3-methoxy-, hydrochloride (6CI,7CI,8CI);2-[4-(Benzyloxy)-3-methoxyphenyl]ethanamine hydrochloride;4-Benzyloxy-3-methoxyphenethylamine hydrochloride |
| CAS: | 1860-57-7 |
| Molecular Formula: | C16H19 N O2 . Cl H |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C16H19NO2/c1-18-16-11-13(9-10-17)7-8-15(16)19-12-14-5-3-2-4-6-14/h2-8,11H,9-10,12,17H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 212.5°C |
| Boiling Point: | 395.1°Cat760mmHg |
| Density: | g/cm3 |
| Refractive index: | 1.571 |
| Flash Point: | 212.5°C |
| Usage: | A phenylethylamine derivative with radioprotective and pharmacological properties |
| Safety Data |
| |
 |
