| Identification | |
| Name: | Xanthic acid, methyl-,ester with 4'-bromo-2-mercaptoacetophenone (8CI) |
| Synonyms: | Xanthicacid, methyl-, ester with 4'-bromo-2-mercaptoacetphenone (7CI); NSC 136540 |
| CAS: | 1861-47-8 |
| Molecular Formula: | C10H9 Br O2 S2 |
| Molecular Weight: | 305.2113 |
| InChI: | InChI=1/C10H9BrO2S2/c1-13-10(14)15-6-9(12)7-2-4-8(11)5-3-7/h2-5H,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 204.5°C |
| Boiling Point: | 414.5°C at 760 mmHg |
| Density: | 1.561g/cm3 |
| Refractive index: | 1.638 |
| Flash Point: | 204.5°C |
| Safety Data | |
 |
|
