Identification |
Name: | Carbonodithioic acid,S-[2-(4-bromophenyl)-2-oxoethyl] O-(3-methylbutyl) ester |
Synonyms: | Xanthicacid, isopentyl-, ester with 4'-bromo-2-mercaptoacetophenone (7CI); NSC 137823 |
CAS: | 1861-54-7 |
Molecular Formula: | C14H17 Br O2 S2 |
Molecular Weight: | 361.3176 |
InChI: | InChI=1/C14H17BrO2S2/c1-10(2)7-8-17-14(18)19-9-13(16)11-3-5-12(15)6-4-11/h3-6,10H,7-9H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 227°C |
Boiling Point: | 451.7°C at 760 mmHg |
Density: | 1.379g/cm3 |
Refractive index: | 1.593 |
Flash Point: | 227°C |
Safety Data |
|
 |