| Identification |
| Name: | 2,4-Pyrimidinediamine,5-nitro- |
| Synonyms: | Pyrimidine,2,4-diamino-5-nitro- (6CI,7CI,8CI); 2,4-Diamino-5-nitropyrimidine;5-Nitro-2,4-pyrimidinediamine; NSC 122004 |
| CAS: | 18620-73-0 |
| Molecular Formula: | C4H5 N5 O2 |
| Molecular Weight: | 155.11 |
| InChI: | InChI=1/C4H5N5O2/c5-3-2(9(10)11)1-7-4(6)8-3/h1H,(H4,5,6,7,8) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 261.6°C |
| Boiling Point: | 509°Cat760mmHg |
| Density: | 1.68g/cm3 |
| Refractive index: | 1.746 |
| Flash Point: | 261.6°C |
| Usage: | Has a strong preferential binding to the enzyme dihydrofolate reductase in competition with the substrate, Dihydrofolic Acid |
| Safety Data |
| |
 |
