Identification |
Name: | 2,4-Pyrimidinediamine,5-nitro- |
Synonyms: | Pyrimidine,2,4-diamino-5-nitro- (6CI,7CI,8CI); 2,4-Diamino-5-nitropyrimidine;5-Nitro-2,4-pyrimidinediamine; NSC 122004 |
CAS: | 18620-73-0 |
Molecular Formula: | C4H5 N5 O2 |
Molecular Weight: | 155.11 |
InChI: | InChI=1/C4H5N5O2/c5-3-2(9(10)11)1-7-4(6)8-3/h1H,(H4,5,6,7,8) |
Molecular Structure: |
 |
Properties |
Flash Point: | 261.6°C |
Boiling Point: | 509°Cat760mmHg |
Density: | 1.68g/cm3 |
Refractive index: | 1.746 |
Flash Point: | 261.6°C |
Usage: | Has a strong preferential binding to the enzyme dihydrofolate reductase in competition with the substrate, Dihydrofolic Acid |
Safety Data |
|
 |