| Identification | |
| Name: | Benzo[a]phenazine,7,12-dioxide |
| Synonyms: | Benzo[a]phenazinedi-N-oxide |
| CAS: | 18636-88-9 |
| Molecular Formula: | C16H10 N2 O2 |
| Molecular Weight: | 272.38 |
| InChI: | InChI=1/C16H10N2O2/c19-17-13-7-3-4-8-14(13)18(20)16-12-6-2-1-5-11(12)9-10-15(16)17/h1-10H |
| Molecular Structure: | ![(C16H10N2O2) Benzo[a]phenazinedi-N-oxide](https://img1.guidechem.com/chem/e/dict/57/18636-88-9.jpg) |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Benzo(a)phenazine di-n-oxide , its CAS number is 18636-88-9, it can be called Benzo[a]phenazine 7,12-dioxide . Benzo(a)phenazine di-n-oxide (CAS NO. 18636-88-9) is a moderately toxic substance, with flammability, burning will produce toxic fumes of nitrogen oxides and hydrogen chloride, so it should be stored in cool and dry environment, dry powder, foam, sand, carbon dioxide, water mist can be used if something urgent happened. |
| Flash Point: | °C |
| Safety Data | |
 |
|
