| Identification | |
| Name: | Benzenecarboximidamide,2-methyl-, hydrochloride (1:1) |
| Synonyms: | Benzenecarboximidamide,2-methyl-, monohydrochloride (9CI);o-Toluamidine, monohydrochloride (8CI);2-Methylbenzamidine hydrochloride; |
| CAS: | 18636-98-1 |
| Molecular Formula: | C8H10N2.HCl |
| Molecular Weight: | 170.64 |
| InChI: | InChI=1/C8H10N2.ClH/c1-6-4-2-3-5-7(6)8(9)10;/h2-5H,1H3,(H3,9,10);1H |
| Molecular Structure: |  |
| Properties | |
| Specification: |
The cas register number of 2-Methylbenzamidine hydrochloride is 18636-98-1. It also can be called as 2-Methylbenzenecarboximidamide monohydrochloride and the Systematic name about this chemical is 2-methylbenzenecarboximidamide hydrochloride. Physical properties about 2-Methylbenzamidine hydrochloride are: (1)ACD/LogP: 1.11; (2)#H bond acceptors: 2; (3)#H bond donors: 3; (4)#Freely Rotating Bonds: 1; (5)Polar Surface Area: 49.87Å2; (6)Flash Point: 116.9 °C; (7)Enthalpy of Vaporization: 51.81 kJ/mol; (8)Boiling Point: 269.7 °C at 760 mmHg; (9)Vapour Pressure: 0.00555 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
