| Identification |
| Name: | 2-Isobutylthiazole |
| Synonyms: | 2-Isobutyl-1,3-thiazole;2-(2-Methylpropyl) thiazole;2-(2-Methylpropyl)thiazole;2-(2-methylpropyl)-1,3-thiazole;Thiazole, 2-(2-methylpropyl)-;Thiazole, 2-isobutyl- (8CI);Thiazole, 2- (2-methylpropyl)-;Thiazole, 2-isobutyl-; |
| CAS: | 18640-74-9 |
| EINECS: | 242-470-1 |
| Molecular Formula: | C7H11NS |
| Molecular Weight: | 141.23 |
| InChI: | InChI=1/C7H11NS/c1-6(2)5-7-8-3-4-9-7/h3-4,6H,5H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 3/PG 3 |
| Density: | 0.99 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.495-1.497 |
| Solubility: | Insoluble |
| Appearance: | Colourless to pale yellow liquid |
| Packinggroup: | III |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
