| Identification |
| Name: | Formic acid,4-nitrophenyl ester |
| Synonyms: | Formicacid, p-nitrophenyl ester (7CI,8CI);4-Nitrophenyl formate;NSC 154301;p-Nitrophenyl formate; |
| CAS: | 1865-01-6 |
| EINECS: | 217-473-6 |
| Molecular Formula: | C7H5NO4 |
| Molecular Weight: | 167.12 |
| InChI: | InChI=1/C7H5NO4/c9-5-12-7-3-1-6(2-4-7)8(10)11/h1-5H |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.363 g/cm3 |
| Refractive index: | 1.56 |
| Water Solubility: | Soluble in chloroform and dichlormethane |
| Solubility: | Soluble in chloroform and dichlormethane |
| Appearance: | Off white powder |
| Storage Temperature: | 2-8°C |
| Sensitive: | Moisture & Light Sensitive |
| Usage: | A selective formylating agent for one of two amino groups in such basic amino acids as ornithine or lysine |
| Safety Data |
| |
 |
